| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| Other names |
|---|
| o-Dichlorobenzene; Benzene, o-dichloro-; Benzene, 1,2-dichloro-; |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H | RFFLAFLAYFXFSW-UHFFFAOYSA-N | ClC1=C(Cl)C=CC=C1 | 1,2-Dichlorobenzene |
| State | Conformation |
|---|---|
| 1A1 | C2V |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
33.00 | kJ mol-1 | webbook | ||
Hfg(0K) ![]() |
kJ mol-1 | webbook |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | A1 | 3072 | 1970Gre:1913 | ||||||
| 2 | A1 | 3072 | |||||||
| 3 | A1 | 1576 | |||||||
| 4 | A1 | 1458 | |||||||
| 5 | A1 | 1276 | |||||||
| 6 | A1 | 1155 | |||||||
| 7 | A1 | 1130 | |||||||
| 8 | A1 | 1040 | |||||||
| 9 | A1 | 660 | |||||||
| 10 | A1 | 480 | |||||||
| 11 | A1 | 202 | |||||||
| 12 | A2 | 975 | |||||||
| 13 | A2 | 850 | |||||||
| 14 | A2 | 695 | |||||||
| 15 | A2 | 504 | |||||||
| 16 | A2 | 152 | |||||||
| 17 | B1 | 940 | |||||||
| 18 | B1 | 748 | |||||||
| 19 | B1 | 435 | |||||||
| 20 | B1 | 239 | |||||||
| 21 | B2 | 3072 | |||||||
| 22 | B2 | 3072 | |||||||
| 23 | B2 | 1576 | |||||||
| 24 | B2 | 1438 | |||||||
| 25 | B2 | 1252 | |||||||
| 26 | B2 | 1130 | |||||||
| 27 | B2 | 1038 | |||||||
| 28 | B2 | 740 | |||||||
| 29 | B2 | 427 | |||||||
| 30 | B2 | 336 | |||||||
| A | B | C | reference | comment |
|---|---|---|---|---|
| 0.06438 | 0.04774 | 0.02741 | 1986Ond/Uea:77 |
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| 5.687102E+07 | amu3Å6 | 2.60410789875552E-112 | gm3 cm6 | |
Point Group C2v
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| C:C | 6 |
| H-C | 4 |
| C-Cl | 2 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C3 |
| C1 | Cl7 |
| C2 | C4 |
| C2 | Cl8 |
| C3 | C5 |
| C3 | H9 |
| C4 | C6 |
| C4 | H10 |
| C5 | C6 |
| C5 | H11 |
| C6 | H12 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1A1 |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 9.060 | 0.020 | webbook |
| Electron Affinity | unc. | reference |
|---|---|---|
| 0.094 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | C2v | 1 | 2 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1A1 | C2v | True | C2v | 1 | 2 | |||||
| squib | reference | DOI |
|---|---|---|
| 1970Gre:1913 | JHS Green "Vibrational spectra of benzene derivatives - IX: o-Disubstituted compounds" Spectrochimica Acta A 1970, 26, 1913-1923 | 10.1016/0584-8539(70)80129-5 |
| 1986Ond/Uea:77 | M Onda, M Ueda, M Atsuki, J Yamaguchi, I Yamaguchi "Microwave spectra and structure of 1,2-dichlorobenzene-3d and -4d" J. Mol. Struct. 147 (1986) 77-84 | 10.1016/0022-2860(86)87060-0 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |