| |
Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology |
| You are here: Experimental > One molecule all properties | |
| INChI | INChIKey | SMILES | IUPAC name |
|---|---|---|---|
| InChI=1S/C60/c1-2-5-6-3(1)8-12-10-4(1)9-11-7(2)17-21-13(5)23-24-14(6)22-18(8)28-20(12)30-26-16(10)15(9)25-29-19(11)27(17)37-41-31(21)33(23)43-44-34(24)32(22)42-38(28)48-40(30)46-36(26)35(25)45-39(29)47(37)55-49(41)51(43)57-52(44)50(42)56(48)59-54(46)53(45)58(55)60(57)59 | XMWRBQBLMFGWIX-UHFFFAOYSA-N | C1(C2=C34)=C5C6=C7C(C8=C9C%10=C%11C(C%12=C%13%14)=C%15%16)=C%11C%15=C6C1=C%17C%16=C%13C(C%18=C%19C%14=C%20C%12=C%10C(C%21=C%20C(C%22=C%21%23)=C%19%24)=C9C%25=C%23C%26=C%27C%22=C%28C%24=C%29%18)=C%17C2=C%29C4=C%28C%27=C%30C3=C5C%31=C%30C%26=C%25C8=C7%31 |
| State | Conformation |
|---|---|
| 1AG | IH |
| Property | Value | Uncertainty | units | Reference | Comment |
|---|---|---|---|---|---|
Hfg(298.15K) ![]() |
2530.00 | 13.00 | kJ mol-1 | 2000Dik/Kab:95-104 | |
Hfg(0K) ![]() |
13.00 | kJ mol-1 | 2000Dik/Kab:95-104 |
| Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
|---|---|---|---|---|---|---|---|---|---|
| Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
| 1 | Ag | 1470 | 2000Cho/Ker:102-112 | ||||||
| 2 | Ag | 498 | |||||||
| 3 | Au | 1078 | |||||||
| 4 | T1g | 1290 | |||||||
| 5 | T1g | 904 | |||||||
| 6 | T1g | 565 | |||||||
| 7 | T1u | 1433 | |||||||
| 8 | T1u | 1180 | |||||||
| 9 | T1u | 577 | |||||||
| 10 | T1u | 526 | |||||||
| 11 | T2g | 1340 | |||||||
| 12 | T2g | 831 | |||||||
| 13 | T2g | 668 | |||||||
| 14 | T2g | 614 | |||||||
| 15 | T2u | 1524 | |||||||
| 16 | T2u | 1142 | |||||||
| 17 | T2u | 955 | |||||||
| 18 | T2u | 716 | |||||||
| 19 | T2u | 340 | |||||||
| 20 | Gg | 1497 | |||||||
| 21 | Gg | 1348 | |||||||
| 22 | Gg | 1040 | |||||||
| 23 | Gg | 758 | |||||||
| 24 | Gg | 592 | |||||||
| 25 | Gg | 485 | |||||||
| 26 | Gu | 1429 | |||||||
| 27 | Gu | 1315 | |||||||
| 28 | Gu | 970 | |||||||
| 29 | Gu | 797 | |||||||
| 30 | Gu | 707 | |||||||
| 31 | Gu | 354 | |||||||
| 32 | Hg | 1576 | |||||||
| 33 | Hg | 1427 | |||||||
| 34 | Hg | 1251 | |||||||
| 35 | Hg | 1101 | |||||||
| 36 | Hg | 775 | |||||||
| 37 | Hg | 711 | |||||||
| 38 | Hg | 431 | |||||||
| 39 | Hg | 267 | |||||||
| 40 | Hu | 1567 | |||||||
| 41 | Hu | 1343 | |||||||
| 42 | Hu | 1214 | |||||||
| 43 | Hu | 737 | |||||||
| 44 | Hu | 694 | |||||||
| 45 | Hu | 535 | |||||||
| 46 | Hu | 403 | |||||||
| A | B | C | reference | comment |
|---|
Product of moments of inertia ![]() | ||||
|---|---|---|---|---|
| amu3Å6 | 0 | gm3 cm6 | ||
Point Group Ih
| Description | Value | unc. | Connectivity | Reference | Comment | |||
|---|---|---|---|---|---|---|---|---|
| Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
| Atom | x (Å) | y (Å) | z (Å) |
|---|
Bond descriptions
| Bond Type | Count |
|---|---|
| C-C | 60 |
| C=C | 30 |
| Atom 1 | Atom 2 |
|---|---|
| C1 | C2 |
| C1 | C5 |
| C1 | C58 |
| C2 | C3 |
| C2 | C15 |
| C3 | C4 |
| C3 | C12 |
| C4 | C5 |
| C4 | C9 |
| C5 | C6 |
| C6 | C7 |
| C6 | C60 |
| C7 | C8 |
| C7 | C29 |
| C8 | C9 |
| C8 | C26 |
| C9 | C10 |
| C10 | C11 |
| C10 | C25 |
| C11 | C12 |
| C11 | C22 |
| C12 | C13 |
| C13 | C14 |
| C13 | C21 |
| C14 | C15 |
| C14 | C18 |
| C15 | C16 |
| C16 | C17 |
| C16 | C57 |
| C17 | C18 |
| C17 | C43 |
| C18 | C19 |
| C19 | C20 |
| C19 | C41 |
| C20 | C21 |
| C20 | C39 |
| C21 | C22 |
| C22 | C23 |
| C23 | C24 |
| C23 | C38 |
| C24 | C25 |
| C24 | C36 |
| C25 | C26 |
| C26 | C27 |
| C27 | C28 |
| C27 | C35 |
| C28 | C29 |
| C28 | C33 |
| C29 | C30 |
| C30 | C31 |
| C30 | C60 |
| C31 | C32 |
| C31 | C54 |
| C32 | C33 |
| C32 | C52 |
| C33 | C34 |
| C34 | C35 |
| C34 | C50 |
| C35 | C36 |
| C36 | C37 |
| C37 | C38 |
| C37 | C49 |
| C38 | C39 |
| C39 | C40 |
| C40 | C41 |
| C40 | C48 |
| C41 | C42 |
| C42 | C43 |
| C42 | C46 |
| C43 | C44 |
| C44 | C45 |
| C44 | C56 |
| C45 | C46 |
| C45 | C53 |
| C46 | C47 |
| C47 | C48 |
| C47 | C51 |
| C48 | C49 |
| C49 | C50 |
| C50 | C51 |
| C51 | C52 |
| C52 | C53 |
| C53 | C54 |
| C54 | C55 |
| C55 | C56 |
| C55 | C59 |
| C56 | C57 |
| C57 | C58 |
| C58 | C59 |
| C59 | C60 |
| Energy (cm-1) | Degeneracy | reference | description |
|---|---|---|---|
| 0 | 1 | 1AG |
| Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
|---|---|---|---|---|
| 7.570 | 0.010 | 1992Yoo/Rus:911 |
| Electron Affinity | unc. | reference |
|---|---|---|
| 2.684 | 0.001 | webbook |
| State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| x | y | z | total | dipole | quadrupole | ||||||||
| 1 | 1 | 1AG | Ih | True | Ih | 0 | 0 | ||||||
| State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| xx | yy | zz | dipole | quadrupole | ||||||||
| 1 | 1 | 1AG | Ih | True | Ih | 0 | 0 | |||||
| alpha | unc. | Reference |
|---|---|---|
| 79.000 | 4.001 | 2000Bal/Bon:5732 |
| squib | reference | DOI |
|---|---|---|
| 1992Yoo/Rus:911 | RK Yoo, B Ruscic, J Berkowitz "Vacuum ultraviolet photoionization mass spectrometric study of C60" J. Chem. Phys. 96, 911 (1992) | 10.1063/1.462112 |
| 2000Bal/Bon:5732 | A Ballard, K Bonin, J Louderback "Absolute Measurement of the optical polarizability of C60" J. Chem. Phys. 113, 5732 (2000) | 10.1063/1.1290472 |
| 2000Cho/Ker:102-112 | CH Choi, M Kertesz, L Mihaly "Vibrational Assignement of All 46 Fundamentals of C60 and C60 6-: Scaled Quantum Mechanical Results Performed in Redundant Internal Coordinates and Compared to Experiments" J. Phys. Chem. A 2000, 104, 102-112 | 10.1021/jp991420h |
| 2000Dik/Kab:95-104 | VV Diky, GJ Kabo "Thermodynamic properties of C60 and C70 fullerenes" Russ. Chem. Rev. 69(2) 95-104 | 10.1070/RC2000v069n02ABEH000535 |
| webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
[email protected]
| Browse | |
|---|---|
| Previous | Next |